C6H9N3O2 — CID 2061007
N-(2-hydroxyethyl)-1H-pyrazole-5-carboxamide (PubChem CID 2061007) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 2061007 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(2-hydroxyethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCO)c1ccn[nH]1 |
| InChI | InChI=1S/C6H9N3O2/c10-4-3-7-6(11)5-1-2-8-9-5/h1-2,10H,3-4H2,(H,7,11)(H,8,9) |
| InChIKey | IAENCFCNHPYZEV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |