C10H17N3OS — CID 127026695
N-(6-sulfanylhexyl)-1H-pyrazole-5-carboxamide (PubChem CID 127026695) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(6-sulfanylhexyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(6-sulfanylhexyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 127026695 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(6-sulfanylhexyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCCCCS)c1ccn[nH]1 |
| InChI | InChI=1S/C10H17N3OS/c14-10(9-5-7-12-13-9)11-6-3-1-2-4-8-15/h5,7,15H,1-4,6,8H2,(H,11,14)(H,12,13) |
| InChIKey | OJQALHBLSWWPHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|