C11H19N3OS — CID 127027020
5-methyl-N-(6-sulfanylhexyl)-1H-pyrazole-3-carboxamide (PubChem CID 127027020) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-methyl-N-(6-sulfanylhexyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-(6-sulfanylhexyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 127027020 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 5-methyl-N-(6-sulfanylhexyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCCCS)n[nH]1 |
| InChI | InChI=1S/C11H19N3OS/c1-9-8-10(14-13-9)11(15)12-6-4-2-3-5-7-16/h8,16H,2-7H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | TZHCBAGBHYAWRF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|