C18H25N3O — CID 20613765
(E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-[4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 20613765) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-[4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 20613765 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)N[C@H]2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C18H25N3O/c1-20(2)16-6-3-14(4-7-16)5-8-18(22)19-17-13-21-11-9-15(17)10-12-21/h3-8,15,17H,9-13H2,1-2H3,(H,19,22)/b8-5+/t17-/m0/s1 |
| InChIKey | ORKVRCOWWZCYKW-JZLODUJNSA-N |
| XLogP | 1.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|