C27H33N3O — CID 129083486
(Z,2E)-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylaminomethylidene)-4-[4-[(4-methylphenyl)methyl]phenyl]but-3-enamide (PubChem CID 129083486) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is (Z,2E)-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylaminomethylidene)-4-[4-[(4-methylphenyl)methyl]phenyl]but-3-enamide.
| Compound Name | (Z,2E)-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylaminomethylidene)-4-[4-[(4-methylphenyl)methyl]phenyl]but-3-enamide |
|---|---|
| PubChem CID | 129083486 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (Z,2E)-N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylaminomethylidene)-4-[4-[(4-methylphenyl)methyl]phenyl]but-3-enamide |
| SMILES | CN/C=C(\C=C/c1ccc(Cc2ccc(C)cc2)cc1)C(=O)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C27H33N3O/c1-20-3-5-22(6-4-20)17-23-9-7-21(8-10-23)11-12-25(18-28-2)27(31)29-26-19-30-15-13-24(26)14-16-30/h3-12,18,24,26,28H,13-17,19H2,1-2H3,(H,29,31)/b12-11-,25-18+ |
| InChIKey | OVSAZVKKNBYWTR-SXZGQXJRSA-N |
| XLogP | 3.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|