C19H26N2O — CID 164636773
N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide (PubChem CID 164636773) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 164636773 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]methyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide |
| SMILES | CC(=Cc1ccc(C)cc1)C(=O)NC[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C19H26N2O/c1-14-3-5-16(6-4-14)11-15(2)19(22)20-12-18-13-21-9-7-17(18)8-10-21/h3-6,11,17-18H,7-10,12-13H2,1-2H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | OBGLORDPAZEUBZ-SFHVURJKSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|