C15H19ClNO- — CID 53312619
1-azabicyclo[2.2.2]octan-3-yl-(4-methylphenyl)methanone chloride (PubChem CID 53312619) has the molecular formula C15H19ClNO- and a molecular weight of 264.78 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl-(4-methylphenyl)methanone chloride.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl-(4-methylphenyl)methanone chloride |
|---|---|
| PubChem CID | 53312619 |
| Molecular Formula | C15H19ClNO- |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl-(4-methylphenyl)methanone chloride |
| SMILES | Cc1ccc(C(=O)C2CN3CCC2CC3)cc1.[Cl-] |
| InChI | InChI=1S/C15H19NO.ClH/c1-11-2-4-13(5-3-11)15(17)14-10-16-8-6-12(14)7-9-16;/h2-5,12,14H,6-10H2,1H3;1H/p-1 |
| InChIKey | DIVNQZHIGXQRFK-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |