About [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone
[(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone (PubChem CID 59816194) has the molecular formula C21H24O
and a molecular weight of 292.42 g/mol. Its IUPAC name is [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone |
| PubChem CID | 59816194 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@H]2CCC[C@H]2c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H24O/c1-14-8-11-17(12-9-14)21(22)19-6-4-5-18(19)20-13-15(2)7-10-16(20)3/h7-13,18-19H,4-6H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | PHLHMEYJKKYNBO-MOPGFXCFSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone?
The IUPAC name of [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone (CID 59816194) is [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone.
What is the SMILES notation for [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone?
The canonical SMILES for [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone is Cc1ccc(C(=O)[C@H]2CCC[C@H]2c2cc(C)ccc2C)cc1.
What is the InChIKey of [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone?
The InChIKey is PHLHMEYJKKYNBO-MOPGFXCFSA-N. The full InChI is InChI=1S/C21H24O/c1-14-8-11-17(12-9-14)21(22)19-6-4-5-18(19)20-13-15(2)7-10-16(20)3/h7-13,18-19H,4-6H2,1-3H3/t18-,19+/m1/s1.
What are the key properties of [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone?
[(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone has a molecular weight of 292.42 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-(2,5-dimethylphenyl)cyclopentyl]-(4-methylphenyl)methanone is sourced from PubChem (CID 59816194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).