About 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine
3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 142194002) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine.
Molecular Properties
| Compound Name | 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| PubChem CID | 142194002 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CNC1CN2CCC1CC2.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H16N2.C7H6O3/c1-9-8-6-10-4-2-7(8)3-5-10;8-4-5-1-2-6(9)7(10)3-5/h7-9H,2-6H2,1H3;1-4,9-10H |
| InChIKey | HGSKKCHQKFNKEY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The IUPAC name of 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine (CID 142194002) is 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine.
What is the SMILES notation for 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The canonical SMILES for 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine is CNC1CN2CCC1CC2.O=Cc1ccc(O)c(O)c1.
What is the InChIKey of 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The InChIKey is HGSKKCHQKFNKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C7H6O3/c1-9-8-6-10-4-2-7(8)3-5-10;8-4-5-1-2-6(9)7(10)3-5/h7-9H,2-6H2,1H3;1-4,9-10H.
What are the key properties of 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine?
3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine has a molecular weight of 278.35 g/mol, XLogP of 1.21, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxybenzaldehyde;N-methyl-1-azabicyclo[2.2.2]octan-3-amine is sourced from PubChem (CID 142194002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).