About 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid
5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 141108952) has the molecular formula C17H19NO5
and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
| PubChem CID | 141108952 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)C1CN2CCC1CC2C(=O)O |
| InChI | InChI=1S/C17H19NO5/c19-14(3-1-10-2-4-15(20)16(21)7-10)12-9-18-6-5-11(12)8-13(18)17(22)23/h1-4,7,11-13,20-21H,5-6,8-9H2,(H,22,23)/b3-1+ |
| InChIKey | XARKSYHWTHYUCP-HNQUOIGGSA-N |
| XLogP | 1.48 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The IUPAC name of 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid (CID 141108952) is 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid.
What is the SMILES notation for 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The canonical SMILES for 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid is O=C(/C=C/c1ccc(O)c(O)c1)C1CN2CCC1CC2C(=O)O.
What is the InChIKey of 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The InChIKey is XARKSYHWTHYUCP-HNQUOIGGSA-N. The full InChI is InChI=1S/C17H19NO5/c19-14(3-1-10-2-4-15(20)16(21)7-10)12-9-18-6-5-11(12)8-13(18)17(22)23/h1-4,7,11-13,20-21H,5-6,8-9H2,(H,22,23)/b3-1+.
What are the key properties of 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid has a molecular weight of 317.34 g/mol, XLogP of 1.48, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid is sourced from PubChem (CID 141108952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).