C17H21NO6 — CID 141141440
2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrate (PubChem CID 141141440) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrate.
| Compound Name | 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrate |
|---|---|
| PubChem CID | 141141440 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrate |
| SMILES | O.O=C(O)C1(C(=O)/C=C/c2ccc(O)c(O)c2)CC2CCN1CC2 |
| InChI | InChI=1S/C17H19NO5.H2O/c19-13-3-1-11(9-14(13)20)2-4-15(21)17(16(22)23)10-12-5-7-18(17)8-6-12;/h1-4,9,12,19-20H,5-8,10H2,(H,22,23);1H2/b4-2+; |
| InChIKey | UTUOAGHEIBPMSI-VEELZWTKSA-N |
| XLogP | 0.79 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|