C27H27NO8 — CID 141195590
methyl 4,5-bis[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 141195590) has the molecular formula C27H27NO8 and a molecular weight of 493.51 g/mol. Its IUPAC name is methyl 4,5-bis[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl 4,5-bis[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 141195590 |
| Molecular Formula | C27H27NO8 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | methyl 4,5-bis[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)C1CC2(C(=O)/C=C/c3ccc(O)c(O)c3)CCN1CC2C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H27NO8/c1-36-26(35)19-14-27(25(34)9-5-17-4-8-22(31)24(33)13-17)10-11-28(19)15-18(27)20(29)6-2-16-3-7-21(30)23(32)12-16/h2-9,12-13,18-19,30-33H,10-11,14-15H2,1H3/b6-2+,9-5+ |
| InChIKey | MLVFQWUNJRVQFD-VDESZNBCSA-N |
| XLogP | 2.63 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|