C23H23ClN2O2S — CID 86606708
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-formylphenyl)-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 86606708) has the molecular formula C23H23ClN2O2S and a molecular weight of 426.97 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-formylphenyl)-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-formylphenyl)-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 86606708 |
| Molecular Formula | C23H23ClN2O2S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-formylphenyl)-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=Cc1ccc(-c2ccc3cc(C(=O)N[C@H]4CN5CCC4CC5)sc3c2)cc1 |
| InChI | InChI=1S/C23H22N2O2S.ClH/c26-14-15-1-3-16(4-2-15)18-5-6-19-12-22(28-21(19)11-18)23(27)24-20-13-25-9-7-17(20)8-10-25;/h1-6,11-12,14,17,20H,7-10,13H2,(H,24,27);1H/t20-;/m0./s1 |
| InChIKey | MQXVJFYRXWZXAI-BDQAORGHSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|