C22H23N3O3S — CID 157486083
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-phenyl-1,2-benzothiazole-3-carboxamide;formic acid (PubChem CID 157486083) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-phenyl-1,2-benzothiazole-3-carboxamide;formic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-phenyl-1,2-benzothiazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 157486083 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-6-phenyl-1,2-benzothiazole-3-carboxamide;formic acid |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1nsc2cc(-c3ccccc3)ccc12.O=CO |
| InChI | InChI=1S/C21H21N3OS.CH2O2/c25-21(22-18-13-24-10-8-15(18)9-11-24)20-17-7-6-16(12-19(17)26-23-20)14-4-2-1-3-5-14;2-1-3/h1-7,12,15,18H,8-11,13H2,(H,22,25);1H,(H,2,3)/t18-;/m0./s1 |
| InChIKey | BWSODLXZADDURE-FERBBOLQSA-N |
| XLogP | 3.49 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|