C18H23N3O5S — CID 161335303
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,6-dimethoxy-1,2-benzothiazole-3-carboxamide;formic acid (PubChem CID 161335303) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,6-dimethoxy-1,2-benzothiazole-3-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,6-dimethoxy-1,2-benzothiazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 161335303 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,6-dimethoxy-1,2-benzothiazole-3-carboxamide;formic acid |
| SMILES | COc1cc2snc(C(=O)N[C@@H]3CN4CCC3CC4)c2cc1OC.O=CO |
| InChI | InChI=1S/C17H21N3O3S.CH2O2/c1-22-13-7-11-15(8-14(13)23-2)24-19-16(11)17(21)18-12-9-20-5-3-10(12)4-6-20;2-1-3/h7-8,10,12H,3-6,9H2,1-2H3,(H,18,21);1H,(H,2,3)/t12-;/m1./s1 |
| InChIKey | VLYMGFKUBZXLPX-UTONKHPSSA-N |
| XLogP | 1.84 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|