C21H27N3O3S — CID 58578133
methyl 5-[3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1,2-benzothiazol-6-yl]pentanoate (PubChem CID 58578133) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is methyl 5-[3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1,2-benzothiazol-6-yl]pentanoate.
| Compound Name | methyl 5-[3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1,2-benzothiazol-6-yl]pentanoate |
|---|---|
| PubChem CID | 58578133 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | methyl 5-[3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1,2-benzothiazol-6-yl]pentanoate |
| SMILES | COC(=O)CCCCc1ccc2c(C(=O)N[C@@H]3CN4CCC3CC4)nsc2c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-27-19(25)5-3-2-4-14-6-7-16-18(12-14)28-23-20(16)21(26)22-17-13-24-10-8-15(17)9-11-24/h6-7,12,15,17H,2-5,8-11,13H2,1H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | FXPQNHVIPBOXMQ-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|