C22H31N5O3S — CID 157242844
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-ethylpiperazin-1-yl)-1,2-benzothiazole-3-carboxamide;formic acid (PubChem CID 157242844) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-ethylpiperazin-1-yl)-1,2-benzothiazole-3-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-ethylpiperazin-1-yl)-1,2-benzothiazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 157242844 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(4-ethylpiperazin-1-yl)-1,2-benzothiazole-3-carboxamide;formic acid |
| SMILES | CCN1CCN(c2ccc3c(C(=O)N[C@@H]4CN5CCC4CC5)nsc3c2)CC1.O=CO |
| InChI | InChI=1S/C21H29N5OS.CH2O2/c1-2-24-9-11-26(12-10-24)16-3-4-17-19(13-16)28-23-20(17)21(27)22-18-14-25-7-5-15(18)6-8-25;2-1-3/h3-4,13,15,18H,2,5-12,14H2,1H3,(H,22,27);1H,(H,2,3)/t18-;/m1./s1 |
| InChIKey | AVKHZBQPTUJCKZ-GMUIIQOCSA-N |
| XLogP | 1.96 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|