C20H21N3O3S2 — CID 11742591
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-thiophen-2-yl-1,2-benzothiazole-3-carboxamide;formic acid (PubChem CID 11742591) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-thiophen-2-yl-1,2-benzothiazole-3-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-thiophen-2-yl-1,2-benzothiazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 11742591 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-thiophen-2-yl-1,2-benzothiazole-3-carboxamide;formic acid |
| SMILES | O=C(N[C@@H]1CN2CCC1CC2)c1nsc2cc(-c3cccs3)ccc12.O=CO |
| InChI | InChI=1S/C19H19N3OS2.CH2O2/c23-19(20-15-11-22-7-5-12(15)6-8-22)18-14-4-3-13(10-17(14)25-21-18)16-2-1-9-24-16;2-1-3/h1-4,9-10,12,15H,5-8,11H2,(H,20,23);1H,(H,2,3)/t15-;/m1./s1 |
| InChIKey | BMZVQEMDQFBKDG-XFULWGLBSA-N |
| XLogP | 3.55 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|