C20H27N5OS2 — CID 87317320
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[methyl(propyl)carbamothioyl]amino]-1,2-benzothiazole-3-carboxamide (PubChem CID 87317320) has the molecular formula C20H27N5OS2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[methyl(propyl)carbamothioyl]amino]-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[methyl(propyl)carbamothioyl]amino]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 87317320 |
| Molecular Formula | C20H27N5OS2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[methyl(propyl)carbamothioyl]amino]-1,2-benzothiazole-3-carboxamide |
| SMILES | CCCN(C)C(=S)Nc1ccc2c(C(=O)N[C@@H]3CN4CCC3CC4)nsc2c1 |
| InChI | InChI=1S/C20H27N5OS2/c1-3-8-24(2)20(27)21-14-4-5-15-17(11-14)28-23-18(15)19(26)22-16-12-25-9-6-13(16)7-10-25/h4-5,11,13,16H,3,6-10,12H2,1-2H3,(H,21,27)(H,22,26)/t16-/m1/s1 |
| InChIKey | DJJCBJGRXFPKJF-MRXNPFEDSA-N |
| XLogP | 3.16 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|