C21H28IN5OS — CID 163841433
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[(2S,4S)-4-iodo-1-methylpyrrolidin-2-yl]methylamino]-1,2-benzothiazole-3-carboxamide (PubChem CID 163841433) has the molecular formula C21H28IN5OS and a molecular weight of 525.46 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[(2S,4S)-4-iodo-1-methylpyrrolidin-2-yl]methylamino]-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[(2S,4S)-4-iodo-1-methylpyrrolidin-2-yl]methylamino]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 163841433 |
| Molecular Formula | C21H28IN5OS |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-[[(2S,4S)-4-iodo-1-methylpyrrolidin-2-yl]methylamino]-1,2-benzothiazole-3-carboxamide |
| SMILES | CN1C[C@@H](I)C[C@H]1CNc1ccc2c(C(=O)N[C@@H]3CN4CCC3CC4)nsc2c1 |
| InChI | InChI=1S/C21H28IN5OS/c1-26-11-14(22)8-16(26)10-23-15-2-3-17-19(9-15)29-25-20(17)21(28)24-18-12-27-6-4-13(18)5-7-27/h2-3,9,13-14,16,18,23H,4-8,10-12H2,1H3,(H,24,28)/t14-,16-,18+/m0/s1 |
| InChIKey | OMIPQQSQSCPTDE-QILLFSRXSA-N |
| XLogP | 3.04 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|