C8H11NO — CID 20614774
1,4,5-trimethyl-3-methylidenepyrrol-2-one (PubChem CID 20614774) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-methylidenepyrrol-2-one.
| Compound Name | 1,4,5-trimethyl-3-methylidenepyrrol-2-one |
|---|---|
| PubChem CID | 20614774 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,4,5-trimethyl-3-methylidenepyrrol-2-one |
| SMILES | C=C1C(=O)N(C)C(C)=C1C |
| InChI | InChI=1S/C8H11NO/c1-5-6(2)8(10)9(4)7(5)3/h2H2,1,3-4H3 |
| InChIKey | PZQJBFSNUCLONO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|