C17H25F3O4 — CID 20615080
[4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 2,2,2-trifluoroacetate (PubChem CID 20615080) has the molecular formula C17H25F3O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 20615080 |
| Molecular Formula | C17H25F3O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 2,2,2-trifluoroacetate |
| SMILES | CCCC1COC(/C=C/C2CCC(OC(=O)C(F)(F)F)CC2)OC1 |
| InChI | InChI=1S/C17H25F3O4/c1-2-3-13-10-22-15(23-11-13)9-6-12-4-7-14(8-5-12)24-16(21)17(18,19)20/h6,9,12-15H,2-5,7-8,10-11H2,1H3/b9-6+ |
| InChIKey | KNNUUAVDQGLKMK-RMKNXTFCSA-N |
| XLogP | 4.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|