C20H30F2O4 — CID 20615081
[4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 5,5-difluoropent-4-enoate (PubChem CID 20615081) has the molecular formula C20H30F2O4 and a molecular weight of 372.45 g/mol. Its IUPAC name is [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 5,5-difluoropent-4-enoate.
| Compound Name | [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 5,5-difluoropent-4-enoate |
|---|---|
| PubChem CID | 20615081 |
| Molecular Formula | C20H30F2O4 |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [4-[(E)-2-(5-propyl-1,3-dioxan-2-yl)ethenyl]cyclohexyl] 5,5-difluoropent-4-enoate |
| SMILES | CCCC1COC(/C=C/C2CCC(OC(=O)CCC=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C20H30F2O4/c1-2-4-16-13-24-20(25-14-16)12-9-15-7-10-17(11-8-15)26-19(23)6-3-5-18(21)22/h5,9,12,15-17,20H,2-4,6-8,10-11,13-14H2,1H3/b12-9+ |
| InChIKey | VMASZOKQAUBIEH-FMIVXFBMSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|