C41H52N2O12 — CID 20617383
tert-butyl N-[3-(2-formyl-3,4,6-trimethoxy-5-methylphenyl)-1-oxo-1-[5,7,8-trimethoxy-6-methyl-4-oxo-1-(phenylmethoxymethyl)-1,3-dihydroisoquinolin-2-yl]propan-2-yl]-N-methylcarbamate (PubChem CID 20617383) has the molecular formula C41H52N2O12 and a molecular weight of 764.87 g/mol. Its IUPAC name is tert-butyl N-[3-(2-formyl-3,4,6-trimethoxy-5-methylphenyl)-1-oxo-1-[5,7,8-trimethoxy-6-methyl-4-oxo-1-(phenylmethoxymethyl)-1,3-dihydroisoquinolin-2-yl]propan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(2-formyl-3,4,6-trimethoxy-5-methylphenyl)-1-oxo-1-[5,7,8-trimethoxy-6-methyl-4-oxo-1-(phenylmethoxymethyl)-1,3-dihydroisoquinolin-2-yl]propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 20617383 |
| Molecular Formula | C41H52N2O12 |
| Molecular Weight | 764.87 g/mol |
| Exact Mass | 764.35 |
| IUPAC Name | tert-butyl N-[3-(2-formyl-3,4,6-trimethoxy-5-methylphenyl)-1-oxo-1-[5,7,8-trimethoxy-6-methyl-4-oxo-1-(phenylmethoxymethyl)-1,3-dihydroisoquinolin-2-yl]propan-2-yl]-N-methylcarbamate |
| SMILES | COc1c(C)c(OC)c(OC)c(C=O)c1CC(C(=O)N1CC(=O)c2c(OC)c(C)c(OC)c(OC)c2C1COCc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H52N2O12/c1-23-33(48-7)26(27(20-44)37(52-11)35(23)50-9)18-28(42(6)40(47)55-41(3,4)5)39(46)43-19-30(45)32-31(29(43)22-54-21-25-16-14-13-15-17-25)38(53-12)36(51-10)24(2)34(32)49-8/h13-17,20,28-29H,18-19,21-22H2,1-12H3 |
| InChIKey | LXARZLPMNZFAHV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.87 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|