C17H23NO4 — CID 57003733
tert-butyl N-(2-oxoethyl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 57003733) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl N-(2-oxoethyl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-(2-oxoethyl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 57003733 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl N-(2-oxoethyl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)N(CC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO4/c1-13(20)15(12-14-8-6-5-7-9-14)18(10-11-19)16(21)22-17(2,3)4/h5-9,11,15H,10,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | ODQPJKZICPFMSY-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|