C8H11N2+ — CID 20617616
1,5-dimethyl-5H-pyrrolo[1,2-a]imidazol-1-ium (PubChem CID 20617616) has the molecular formula C8H11N2+ and a molecular weight of 135.19 g/mol. Its IUPAC name is 1,5-dimethyl-5H-pyrrolo[1,2-a]imidazol-1-ium.
| Compound Name | 1,5-dimethyl-5H-pyrrolo[1,2-a]imidazol-1-ium |
|---|---|
| PubChem CID | 20617616 |
| Molecular Formula | C8H11N2+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1,5-dimethyl-5H-pyrrolo[1,2-a]imidazol-1-ium |
| SMILES | CC1C=Cc2n1cc[n+]2C |
| InChI | InChI=1S/C8H11N2/c1-7-3-4-8-9(2)5-6-10(7)8/h3-7H,1-2H3/q+1 |
| InChIKey | XLIVXSSXEYDVKX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|