C38H31GaN2O3 — CID 20617968
cyclohexa-1,3-dien-1-yloxy-bis[(2-methyl-5-phenylquinolin-8-yl)oxy]gallane (PubChem CID 20617968) has the molecular formula C38H31GaN2O3 and a molecular weight of 633.40 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yloxy-bis[(2-methyl-5-phenylquinolin-8-yl)oxy]gallane.
| Compound Name | cyclohexa-1,3-dien-1-yloxy-bis[(2-methyl-5-phenylquinolin-8-yl)oxy]gallane |
|---|---|
| PubChem CID | 20617968 |
| Molecular Formula | C38H31GaN2O3 |
| Molecular Weight | 633.40 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | cyclohexa-1,3-dien-1-yloxy-bis[(2-methyl-5-phenylquinolin-8-yl)oxy]gallane |
| SMILES | Cc1ccc2c(-c3ccccc3)ccc(O[Ga](OC3=CC=CCC3)Oc3ccc(-c4ccccc4)c4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/2C16H13NO.C6H8O.Ga/c2*1-11-7-8-14-13(12-5-3-2-4-6-12)9-10-15(18)16(14)17-11;7-6-4-2-1-3-5-6;/h2*2-10,18H,1H3;1-2,4,7H,3,5H2;/q;;;+3/p-3 |
| InChIKey | HSVPEKDFIWWABE-UHFFFAOYSA-K |
| XLogP | 9.43 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.40 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |