C19H24N3O2S+ — CID 20619529
4-methyl-2-(3-morpholin-4-ylpropylamino)benzo[e][1,3]benzothiazol-1-ium-5-ol (PubChem CID 20619529) has the molecular formula C19H24N3O2S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-methyl-2-(3-morpholin-4-ylpropylamino)benzo[e][1,3]benzothiazol-1-ium-5-ol.
| Compound Name | 4-methyl-2-(3-morpholin-4-ylpropylamino)benzo[e][1,3]benzothiazol-1-ium-5-ol |
|---|---|
| PubChem CID | 20619529 |
| Molecular Formula | C19H24N3O2S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-methyl-2-(3-morpholin-4-ylpropylamino)benzo[e][1,3]benzothiazol-1-ium-5-ol |
| SMILES | Cc1c(O)c2ccccc2c2[nH+]c(NCCCN3CCOCC3)sc12 |
| InChI | InChI=1S/C19H23N3O2S/c1-13-17(23)15-6-3-2-5-14(15)16-18(13)25-19(21-16)20-7-4-8-22-9-11-24-12-10-22/h2-3,5-6,23H,4,7-12H2,1H3,(H,20,21)/p+1 |
| InChIKey | VABLMGBFOLXZIH-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|