C14H10OS — CID 20621339
(2-hepta-1,3,5-triynylsulfanylphenyl)methanol (PubChem CID 20621339) has the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. Its IUPAC name is (2-hepta-1,3,5-triynylsulfanylphenyl)methanol.
| Compound Name | (2-hepta-1,3,5-triynylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 20621339 |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (2-hepta-1,3,5-triynylsulfanylphenyl)methanol |
| SMILES | CC#CC#CC#CSc1ccccc1CO |
| InChI | InChI=1S/C14H10OS/c1-2-3-4-5-8-11-16-14-10-7-6-9-13(14)12-15/h6-7,9-10,15H,12H2,1H3 |
| InChIKey | KMYNNSNCZIQLGN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|