C15H9NS — CID 20621338
2-(2-hepta-1,3,5-triynylsulfanylphenyl)acetonitrile (PubChem CID 20621338) has the molecular formula C15H9NS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(2-hepta-1,3,5-triynylsulfanylphenyl)acetonitrile.
| Compound Name | 2-(2-hepta-1,3,5-triynylsulfanylphenyl)acetonitrile |
|---|---|
| PubChem CID | 20621338 |
| Molecular Formula | C15H9NS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(2-hepta-1,3,5-triynylsulfanylphenyl)acetonitrile |
| SMILES | CC#CC#CC#CSc1ccccc1CC#N |
| InChI | InChI=1S/C15H9NS/c1-2-3-4-5-8-13-17-15-10-7-6-9-14(15)11-12-16/h6-7,9-10H,11H2,1H3 |
| InChIKey | JRWLZJFFFAHKOQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|