C11H14N2O — CID 130639969
2-[2-[(1R,2R)-1-amino-2-hydroxypropyl]phenyl]acetonitrile (PubChem CID 130639969) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-[2-[(1R,2R)-1-amino-2-hydroxypropyl]phenyl]acetonitrile.
| Compound Name | 2-[2-[(1R,2R)-1-amino-2-hydroxypropyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 130639969 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-[2-[(1R,2R)-1-amino-2-hydroxypropyl]phenyl]acetonitrile |
| SMILES | C[C@@H](O)[C@H](N)c1ccccc1CC#N |
| InChI | InChI=1S/C11H14N2O/c1-8(14)11(13)10-5-3-2-4-9(10)6-7-12/h2-5,8,11,14H,6,13H2,1H3/t8-,11+/m1/s1 |
| InChIKey | LEFUTMWGKVJZST-KCJUWKMLSA-N |
| XLogP | 1.13 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |