C10H15NO2 — CID 131209275
(1R,2R)-1-amino-1-[2-(hydroxymethyl)phenyl]propan-2-ol (PubChem CID 131209275) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (1R,2R)-1-amino-1-[2-(hydroxymethyl)phenyl]propan-2-ol.
| Compound Name | (1R,2R)-1-amino-1-[2-(hydroxymethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 131209275 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (1R,2R)-1-amino-1-[2-(hydroxymethyl)phenyl]propan-2-ol |
| SMILES | C[C@@H](O)[C@H](N)c1ccccc1CO |
| InChI | InChI=1S/C10H15NO2/c1-7(13)10(11)9-5-3-2-4-8(9)6-12/h2-5,7,10,12-13H,6,11H2,1H3/t7-,10+/m1/s1 |
| InChIKey | WSILAIRADKCLCT-XCBNKYQSSA-N |
| XLogP | 0.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |