C28H23F4N3O — CID 20621771
2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[6-[(E)-pent-3-enyl]-3-pyridinyl]pyrimidine (PubChem CID 20621771) has the molecular formula C28H23F4N3O and a molecular weight of 493.50 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[6-[(E)-pent-3-enyl]-3-pyridinyl]pyrimidine.
| Compound Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[6-[(E)-pent-3-enyl]-3-pyridinyl]pyrimidine |
|---|---|
| PubChem CID | 20621771 |
| Molecular Formula | C28H23F4N3O |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[6-[(E)-pent-3-enyl]-3-pyridinyl]pyrimidine |
| SMILES | C/C=C/CCc1ccc(-c2cnc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)nc2)cn1 |
| InChI | InChI=1S/C28H23F4N3O/c1-3-5-6-7-19-9-8-17(14-33-19)18-15-34-28(35-16-18)22-11-10-20(24(29)26(22)31)21-12-13-23(36-4-2)27(32)25(21)30/h3,5,8-16H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | NZGURBAQAOGBRN-HWKANZROSA-N |
| XLogP | 7.34 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|