C27H29F2N3O — CID 20621805
5-[5-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-2-pyridinyl]-2-prop-2-enylpyrimidine (PubChem CID 20621805) has the molecular formula C27H29F2N3O and a molecular weight of 449.55 g/mol. Its IUPAC name is 5-[5-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-2-pyridinyl]-2-prop-2-enylpyrimidine.
| Compound Name | 5-[5-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-2-pyridinyl]-2-prop-2-enylpyrimidine |
|---|---|
| PubChem CID | 20621805 |
| Molecular Formula | C27H29F2N3O |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 5-[5-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]-2-pyridinyl]-2-prop-2-enylpyrimidine |
| SMILES | C=CCc1ncc(-c2ccc(C3CCC(c4ccc(OCCC)c(F)c4F)CC3)cn2)cn1 |
| InChI | InChI=1S/C27H29F2N3O/c1-3-5-25-31-16-21(17-32-25)23-12-10-20(15-30-23)18-6-8-19(9-7-18)22-11-13-24(33-14-4-2)27(29)26(22)28/h3,10-13,15-19H,1,4-9,14H2,2H3 |
| InChIKey | SZLIDAPSGPILJW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|