C29H22F5NO — CID 20621812
2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]pyridine (PubChem CID 20621812) has the molecular formula C29H22F5NO and a molecular weight of 495.49 g/mol. Its IUPAC name is 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]pyridine.
| Compound Name | 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]pyridine |
|---|---|
| PubChem CID | 20621812 |
| Molecular Formula | C29H22F5NO |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]pyridine |
| SMILES | C=CCCc1ccc(-c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)cc2F)cn1 |
| InChI | InChI=1S/C29H22F5NO/c1-3-5-6-19-9-7-18(16-35-19)20-10-8-17(15-24(20)30)21-11-12-22(27(32)26(21)31)23-13-14-25(36-4-2)29(34)28(23)33/h3,7-16H,1,4-6H2,2H3 |
| InChIKey | BUAWGDCAXPVTNK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|