C28H20F5NO — CID 20621880
2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]-5-prop-2-enylpyridine (PubChem CID 20621880) has the molecular formula C28H20F5NO and a molecular weight of 481.46 g/mol. Its IUPAC name is 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]-5-prop-2-enylpyridine.
| Compound Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]-5-prop-2-enylpyridine |
|---|---|
| PubChem CID | 20621880 |
| Molecular Formula | C28H20F5NO |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-fluorophenyl]-5-prop-2-enylpyridine |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)cc2F)nc1 |
| InChI | InChI=1S/C28H20F5NO/c1-3-5-16-6-12-23(34-15-16)21-8-7-17(14-22(21)29)18-9-10-19(26(31)25(18)30)20-11-13-24(35-4-2)28(33)27(20)32/h3,6-15H,1,4-5H2,2H3 |
| InChIKey | KSUURECFKBKVMF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|