C9H8F3O4S- — CID 20621959
2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate (PubChem CID 20621959) has the molecular formula C9H8F3O4S- and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 20621959 |
| Molecular Formula | C9H8F3O4S- |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate |
| SMILES | Cc1ccc(OCC(F)(F)F)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H9F3O4S/c1-6-2-3-7(16-5-9(10,11)12)4-8(6)17(13,14)15/h2-4H,5H2,1H3,(H,13,14,15)/p-1 |
| InChIKey | GHWHBJQUNDJFME-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|