C20H26O4 — CID 20621990
3-(10-acetyl-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-4-methyloxolane-2,5-dione (PubChem CID 20621990) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 3-(10-acetyl-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-4-methyloxolane-2,5-dione.
| Compound Name | 3-(10-acetyl-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 20621990 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3-(10-acetyl-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-4-methyloxolane-2,5-dione |
| SMILES | CC(=O)C1CC2CC1C1C3CC(C(C)C3C3C(=O)OC(=O)C3C)C21 |
| InChI | InChI=1S/C20H26O4/c1-7-11-6-14(15(7)16-8(2)19(22)24-20(16)23)18-13-5-10(17(11)18)4-12(13)9(3)21/h7-8,10-18H,4-6H2,1-3H3 |
| InChIKey | BJFYVKDAYZQNJG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|