C21H31N5O3 — CID 20622470
10-(4,6-diazaspiro[2.5]oct-5-en-5-ylamino)-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid (PubChem CID 20622470) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 10-(4,6-diazaspiro[2.5]oct-5-en-5-ylamino)-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid.
| Compound Name | 10-(4,6-diazaspiro[2.5]oct-5-en-5-ylamino)-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid |
|---|---|
| PubChem CID | 20622470 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 10-(4,6-diazaspiro[2.5]oct-5-en-5-ylamino)-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid |
| SMILES | Cc1ncc(C(CCCCCCC(=O)NC2=NCCC3(CC3)N2)CC(=O)O)cn1 |
| InChI | InChI=1S/C21H31N5O3/c1-15-23-13-17(14-24-15)16(12-19(28)29)6-4-2-3-5-7-18(27)25-20-22-11-10-21(26-20)8-9-21/h13-14,16H,2-12H2,1H3,(H,28,29)(H2,22,25,26,27) |
| InChIKey | GQPWVVCOKPZULL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|