C14H20F2N2O2 — CID 91149685
5,5-difluoro-3-(2-methylpyrimidin-5-yl)nonanoic acid (PubChem CID 91149685) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 5,5-difluoro-3-(2-methylpyrimidin-5-yl)nonanoic acid.
| Compound Name | 5,5-difluoro-3-(2-methylpyrimidin-5-yl)nonanoic acid |
|---|---|
| PubChem CID | 91149685 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 5,5-difluoro-3-(2-methylpyrimidin-5-yl)nonanoic acid |
| SMILES | CCCCC(F)(F)CC(CC(=O)O)c1cnc(C)nc1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-4-5-14(15,16)7-11(6-13(19)20)12-8-17-10(2)18-9-12/h8-9,11H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | LTRARIGNPOLVOA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |