C24H30F3N3O3 — CID 145142564
(Z,3S)-10-methylidene-12-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)-5-oxo-3-[2-(trifluoromethyl)pyrimidin-5-yl]dodec-11-enoic acid (PubChem CID 145142564) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is (Z,3S)-10-methylidene-12-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)-5-oxo-3-[2-(trifluoromethyl)pyrimidin-5-yl]dodec-11-enoic acid.
| Compound Name | (Z,3S)-10-methylidene-12-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)-5-oxo-3-[2-(trifluoromethyl)pyrimidin-5-yl]dodec-11-enoic acid |
|---|---|
| PubChem CID | 145142564 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (Z,3S)-10-methylidene-12-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)-5-oxo-3-[2-(trifluoromethyl)pyrimidin-5-yl]dodec-11-enoic acid |
| SMILES | C=C(/C=C\C1=C(C)NCCC1)CCCCC(=O)CC(CC(=O)O)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C24H30F3N3O3/c1-16(9-10-18-7-5-11-28-17(18)2)6-3-4-8-21(31)12-19(13-22(32)33)20-14-29-23(30-15-20)24(25,26)27/h9-10,14-15,19,28H,1,3-8,11-13H2,2H3,(H,32,33)/b10-9- |
| InChIKey | VGQUPSIJLXUHMO-KTKRTIGZSA-N |
| XLogP | 5.34 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|