C21H33N5O3 — CID 58765560
(3S)-10-[[(4S,6S)-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-yl]amino]-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid (PubChem CID 58765560) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is (3S)-10-[[(4S,6S)-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-yl]amino]-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid.
| Compound Name | (3S)-10-[[(4S,6S)-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-yl]amino]-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid |
|---|---|
| PubChem CID | 58765560 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (3S)-10-[[(4S,6S)-4,6-dimethyl-1,4,5,6-tetrahydropyrimidin-2-yl]amino]-3-(2-methylpyrimidin-5-yl)-10-oxodecanoic acid |
| SMILES | Cc1ncc([C@@H](CCCCCCC(=O)NC2=N[C@@H](C)C[C@H](C)N2)CC(=O)O)cn1 |
| InChI | InChI=1S/C21H33N5O3/c1-14-10-15(2)25-21(24-14)26-19(27)9-7-5-4-6-8-17(11-20(28)29)18-12-22-16(3)23-13-18/h12-15,17H,4-11H2,1-3H3,(H,28,29)(H2,24,25,26,27)/t14-,15-,17-/m0/s1 |
| InChIKey | JDPBNCPTHQPSLE-ZOBUZTSGSA-N |
| XLogP | 2.93 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|