C22H28F2N4O2 — CID 91169567
5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-1-yl)nonanoic acid (PubChem CID 91169567) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-1-yl)nonanoic acid.
| Compound Name | 5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-1-yl)nonanoic acid |
|---|---|
| PubChem CID | 91169567 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydropyrido[2,3-b]azepin-1-yl)nonanoic acid |
| SMILES | O=C(O)CC(CC(F)(F)CCCCN1C=CC=C2CCCCN=C21)c1cncnc1 |
| InChI | InChI=1S/C22H28F2N4O2/c23-22(24,13-18(12-20(29)30)19-14-25-16-26-15-19)8-2-4-10-28-11-5-7-17-6-1-3-9-27-21(17)28/h5,7,11,14-16,18H,1-4,6,8-10,12-13H2,(H,29,30) |
| InChIKey | GWDVASRTQUENKJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|