C24H36N4O2 — CID 142277668
ethane;3-pyrimidin-5-yl-9-(2,3,4,5-tetrahydro-1H-pyrido[2,3-b]azepin-8-yl)nonanoic acid (PubChem CID 142277668) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is ethane;3-pyrimidin-5-yl-9-(2,3,4,5-tetrahydro-1H-pyrido[2,3-b]azepin-8-yl)nonanoic acid.
| Compound Name | ethane;3-pyrimidin-5-yl-9-(2,3,4,5-tetrahydro-1H-pyrido[2,3-b]azepin-8-yl)nonanoic acid |
|---|---|
| PubChem CID | 142277668 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethane;3-pyrimidin-5-yl-9-(2,3,4,5-tetrahydro-1H-pyrido[2,3-b]azepin-8-yl)nonanoic acid |
| SMILES | CC.O=C(O)CC(CCCCCCC1=NC2=C(CC=C1)CCCN2)c1cncnc1 |
| InChI | InChI=1S/C22H30N4O2.C2H6/c27-21(28)13-18(19-14-23-16-24-15-19)7-3-1-2-4-10-20-11-5-8-17-9-6-12-25-22(17)26-20;1-2/h5,11,14-16,18,25H,1-4,6-10,12-13H2,(H,27,28);1-2H3 |
| InChIKey | CWXVAULKEGQZKD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|