C19H26N4O2 — CID 20622646
4-(8-pentanoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide (PubChem CID 20622646) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-(8-pentanoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide.
| Compound Name | 4-(8-pentanoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 20622646 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-(8-pentanoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC3(CCN(C(=O)CCCC)CC3)C2)cc1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-3-4-17(24)23-11-9-19(10-12-23)13-16(22-25-19)14-5-7-15(8-6-14)18(20)21/h5-8H,2-4,9-13H2,1H3,(H3,20,21) |
| InChIKey | YMCWXJIVYTUQFU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|