C20H27N3O3 — CID 20622676
9-[2-(4-ethanimidoylphenyl)acetyl]-3-ethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 20622676) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 9-[2-(4-ethanimidoylphenyl)acetyl]-3-ethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 9-[2-(4-ethanimidoylphenyl)acetyl]-3-ethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 20622676 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 9-[2-(4-ethanimidoylphenyl)acetyl]-3-ethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | [H]/N=C(\C)c1ccc(CC(=O)N2CCC3(CC2)CCN(CC)C(=O)O3)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-3-22-11-8-20(26-19(22)25)9-12-23(13-10-20)18(24)14-16-4-6-17(7-5-16)15(2)21/h4-7,21H,3,8-14H2,1-2H3/b21-15+ |
| InChIKey | XROJYCMVTKTSPH-RCCKNPSSSA-N |
| XLogP | 2.84 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|