C24H34N4O5 — CID 59043079
tert-butyl N-[amino-[4-[2-(3-ethyl-2-oxo-1-oxa-3,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]phenyl]methylidene]carbamate (PubChem CID 59043079) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl N-[amino-[4-[2-(3-ethyl-2-oxo-1-oxa-3,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]phenyl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[4-[2-(3-ethyl-2-oxo-1-oxa-3,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 59043079 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | tert-butyl N-[amino-[4-[2-(3-ethyl-2-oxo-1-oxa-3,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]phenyl]methylidene]carbamate |
| SMILES | CCN1CCC2(CCN(C(=O)Cc3ccc(C(N)=NC(=O)OC(C)(C)C)cc3)CC2)OC1=O |
| InChI | InChI=1S/C24H34N4O5/c1-5-27-13-10-24(33-22(27)31)11-14-28(15-12-24)19(29)16-17-6-8-18(9-7-17)20(25)26-21(30)32-23(2,3)4/h6-9H,5,10-16H2,1-4H3,(H2,25,26,30) |
| InChIKey | NBEDUNDBDFORFY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|