C12H11F3N2S2 — CID 20622980
[1-methyl-5-phenylsulfanyl-3-(trifluoromethyl)pyrazol-4-yl]methanethiol (PubChem CID 20622980) has the molecular formula C12H11F3N2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is [1-methyl-5-phenylsulfanyl-3-(trifluoromethyl)pyrazol-4-yl]methanethiol.
| Compound Name | [1-methyl-5-phenylsulfanyl-3-(trifluoromethyl)pyrazol-4-yl]methanethiol |
|---|---|
| PubChem CID | 20622980 |
| Molecular Formula | C12H11F3N2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [1-methyl-5-phenylsulfanyl-3-(trifluoromethyl)pyrazol-4-yl]methanethiol |
| SMILES | Cn1nc(C(F)(F)F)c(CS)c1Sc1ccccc1 |
| InChI | InChI=1S/C12H11F3N2S2/c1-17-11(19-8-5-3-2-4-6-8)9(7-18)10(16-17)12(13,14)15/h2-6,18H,7H2,1H3 |
| InChIKey | UYMIPLLEBSBOEB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|