C23H30N4O3 — CID 20623000
2-[[2-(3,3-dimethylbut-1-ynyl)-4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 20623000) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[[2-(3,3-dimethylbut-1-ynyl)-4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(3,3-dimethylbut-1-ynyl)-4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 20623000 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[[2-(3,3-dimethylbut-1-ynyl)-4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccc(NCc2cnc[nH]2)cc1C#CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H30N4O3/c1-15(2)10-20(22(29)30)27-21(28)19-7-6-17(25-13-18-12-24-14-26-18)11-16(19)8-9-23(3,4)5/h6-7,11-12,14-15,20,25H,10,13H2,1-5H3,(H,24,26)(H,27,28)(H,29,30) |
| InChIKey | WIMAIIMXJVCQCY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|