C26H30N4O3 — CID 20623660
3-cyclohexyl-2-[[4-(1H-imidazol-5-ylmethylamino)-2-phenylbenzoyl]amino]propanoic acid (PubChem CID 20623660) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-cyclohexyl-2-[[4-(1H-imidazol-5-ylmethylamino)-2-phenylbenzoyl]amino]propanoic acid.
| Compound Name | 3-cyclohexyl-2-[[4-(1H-imidazol-5-ylmethylamino)-2-phenylbenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20623660 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-cyclohexyl-2-[[4-(1H-imidazol-5-ylmethylamino)-2-phenylbenzoyl]amino]propanoic acid |
| SMILES | O=C(NC(CC1CCCCC1)C(=O)O)c1ccc(NCc2cnc[nH]2)cc1-c1ccccc1 |
| InChI | InChI=1S/C26H30N4O3/c31-25(30-24(26(32)33)13-18-7-3-1-4-8-18)22-12-11-20(28-16-21-15-27-17-29-21)14-23(22)19-9-5-2-6-10-19/h2,5-6,9-12,14-15,17-18,24,28H,1,3-4,7-8,13,16H2,(H,27,29)(H,30,31)(H,32,33) |
| InChIKey | ACNGNOIXIMQLBX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |